CAS 130793-28-1: (2S,3R,5S)-5-(2-formamido-4-methyl-pentanoyl)oxy-2-hexyl-3-hydroxy-hexadecanoic acid
Description:The chemical substance with the name "(2S,3R,5S)-5-(2-formamido-4-methyl-pentanoyl)oxy-2-hexyl-3-hydroxy-hexadecanoic acid" and CAS number "130793-28-1" is a complex organic compound characterized by its specific stereochemistry and functional groups. It features multiple chiral centers, which contribute to its unique three-dimensional structure and potential biological activity. The presence of a formamido group indicates that it may participate in various biochemical interactions, while the hexyl and hexadecanoic acid moieties suggest hydrophobic characteristics that could influence its solubility and membrane interactions. The hydroxyl group enhances its polarity, potentially affecting its reactivity and interactions with other molecules. This compound may be of interest in pharmaceutical or biochemical research due to its structural complexity and potential applications in drug development or as a biochemical probe. Its specific properties, such as melting point, solubility, and reactivity, would require empirical investigation to fully characterize its behavior in various environments.
Formula:C29H55NO6
InChI:InChI=1S/C29H55NO6/c1-5-7-9-11-12-13-14-15-16-18-24(36-29(35)26(30-22-31)20-23(3)4)21-27(32)25(28(33)34)19-17-10-8-6-2/h22-27,32H,5-21H2,1-4H3,(H,30,31)(H,33,34)/t24-,25-,26-,27+/m0/s1
InChI key:InChIKey=FKUNIADJSAJLGB-YIPNQBBMSA-N
SMILES:O=CNC(C(=O)OC(CCCCCCCCCCC)CC(O)C(C(=O)O)CCCCCC)CC(C)C