CymitQuimica logo

CAS 130793-30-5

:

(3S,5S)-2-hexyl-3,5-dihydroxy-hexadecanoic acid

Description:
(3S,5S)-2-hexyl-3,5-dihydroxy-hexadecanoic acid is a chemical compound characterized by its long hydrocarbon chain and multiple hydroxyl groups, which contribute to its hydrophilic properties. The presence of two hydroxyl groups at the 3 and 5 positions on the hexadecanoic acid backbone enhances its solubility in polar solvents and may influence its biological activity. The hexyl group at the 2 position adds to the lipophilicity of the molecule, making it amphiphilic, which can affect its interactions with biological membranes. This compound is likely to exhibit surfactant properties, potentially making it useful in various applications, including pharmaceuticals, cosmetics, and as a biochemical reagent. Its stereochemistry, indicated by the (3S,5S) configuration, suggests specific spatial arrangements that can influence its reactivity and interactions with other molecules. Overall, the unique combination of hydrophobic and hydrophilic characteristics, along with its structural features, makes this compound of interest in both research and industrial applications.
Formula:C22H44O4
InChI:InChI=1/C22H44O4/c1-3-5-7-9-10-11-12-13-14-16-19(23)18-21(24)20(22(25)26)17-15-8-6-4-2/h19-21,23-24H,3-18H2,1-2H3,(H,25,26)/t19-,20?,21-/m0/s1
SMILES:CCCCCCCCCCC[C@@H](C[C@@H](C(CCCCCC)C(=O)O)O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.