CAS 130796-15-5
:2,3,4,6-Tetra-O-acetyl-1-S-acetyl-1-thio-a-D-galactopyranoside
Description:
2,3,4,6-Tetra-O-acetyl-1-S-acetyl-1-thio-α-D-galactopyranoside is a thio-glycoside derivative of galactose, characterized by the presence of multiple acetyl groups that enhance its stability and solubility. This compound features a thioether linkage, which contributes to its unique reactivity compared to typical glycosides. The acetyl groups serve to protect the hydroxyl functionalities, making it a useful intermediate in synthetic organic chemistry, particularly in carbohydrate chemistry. The presence of the thio group can impart different chemical properties, such as increased nucleophilicity, which can be exploited in various reactions. This compound is typically used in research settings, particularly in studies involving glycosylation reactions or the synthesis of more complex carbohydrate structures. Its specific stereochemistry, indicated by the α configuration, plays a crucial role in determining its biological activity and interaction with enzymes. Overall, 2,3,4,6-Tetra-O-acetyl-1-S-acetyl-1-thio-α-D-galactopyranoside is a valuable compound for chemists working with carbohydrates and thio-glycosides.
Formula:C16H22O10S
InChI:InChI=1/C16H22O10S/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(26-12)27-11(5)21/h12-16H,6H2,1-5H3/t12?,13-,14-,15-,16+/m0/s1
Synonyms:- 1,2,3,4,6-Penta-O-acetyl-a-D-thiogalactopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-D-Galactopyranose, 1-thio-, 1,2,3,4,6-pentaacetate
CAS:Formula:C16H32O15SColor and Shape:SolidMolecular weight:496.48131,2,3,4,6-Penta-O-acetyl-a-D-thiogalactopyranose
CAS:1,2,3,4,6-Penta-O-acetyl-a-D-thiogalactopyranose is a fluorinated saccharide that can be used as a research tool. It has been modified with methylation and glycosylation. This product is purified and custom synthesized to meet customer specifications.
Formula:C16H22O10SPurity:Min. 95%Molecular weight:406.41 g/mol


