CAS 130798-49-1
:2-Carboxy-4-chloro-1H-indole-3-propanoic acid
Description:
2-Carboxy-4-chloro-1H-indole-3-propanoic acid, with the CAS number 130798-49-1, is a chemical compound that belongs to the indole family, characterized by its indole ring structure fused with a propanoic acid side chain. This compound features a carboxylic acid group and a chlorine substituent, which contribute to its unique chemical properties. It is typically a solid at room temperature and is soluble in polar solvents, reflecting its acidic nature due to the carboxylic acid group. The presence of the chlorine atom can influence its reactivity and biological activity, making it of interest in pharmaceutical research. This compound may exhibit various biological activities, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. As with many chemical substances, handling should be done with care, adhering to safety protocols to mitigate any risks associated with its use.
Formula:C12H10ClNO4
InChI:InChI=1S/C12H10ClNO4/c13-7-2-1-3-8-10(7)6(4-5-9(15)16)11(14-8)12(17)18/h1-3,14H,4-5H2,(H,15,16)(H,17,18)
InChI key:InChIKey=SSLBZYLQLVRPAQ-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C=1C=2C(NC1C(O)=O)=CC=CC2Cl
Synonyms:- 1H-Indole-3-propanoic acid, 2-carboxy-4-chloro-
- 2-Carboxy-4-chloro-1H-indole-3-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
