CAS 13080-10-9
:4-Amino-2-phenylbutanoic acid
Description:
4-Amino-2-phenylbutanoic acid, also known as phenylalanine derivative, is an amino acid characterized by its structure, which includes an amino group, a carboxylic acid group, and a phenyl group attached to a butanoic acid backbone. This compound is typically a white to off-white crystalline solid and is soluble in water, reflecting its polar nature due to the presence of both amino and carboxylic acid functional groups. It exhibits properties typical of amino acids, such as the ability to participate in peptide bond formation, making it relevant in biochemical processes. The compound can exist in different ionic forms depending on the pH of the solution, which influences its solubility and reactivity. Additionally, it may have applications in pharmaceuticals and biochemistry, particularly in studies related to protein synthesis and metabolic pathways. Its CAS number, 13080-10-9, is a unique identifier that facilitates its recognition in chemical databases and regulatory frameworks.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2.ClH/c11-7-6-9(10(12)13)8-4-2-1-3-5-8;/h1-5,9H,6-7,11H2,(H,12,13);1H
SMILES:c1ccc(cc1)C(CCN)C(=O)O.Cl
Synonyms:- alpha-Phenyl-gamma-aminobutyric acid
- 4-Amino-2-phenyl-butyric acid
- Brn 2804881
- alpha-Phenyl gaba
- Butyric acid, 4-amino-2-phenyl-
- 3-Carboxy-3-Phenylpropan-1-Aminium Chloride
- 4-amino-2-phenylbutanoic acid
- α-Phenyl GABA
- 2-Phenyl-4-aminobutanoic acid
- Benzeneacetic acid, α-(2-aminoethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
