CymitQuimica logo

CAS 13080-85-8

:

4,4'-(1,1'-biphenyl-4,4'-diyldioxy)-dianiline

Description:
4,4'-(1,1'-Biphenyl-4,4'-diyldioxy)-dianiline, identified by its CAS number 13080-85-8, is an organic compound characterized by its biphenyl structure and the presence of two aniline groups. This compound features a central biphenyl moiety connected by ether linkages to two aniline units, which contributes to its potential applications in materials science, particularly in the development of polymers and dyes. The presence of the amino groups (-NH2) allows for further chemical reactivity, making it suitable for various synthetic pathways. Additionally, the biphenyl structure can impart unique electronic properties, which may enhance conductivity or stability in certain applications. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling, as compounds with amine functionalities can pose health risks if not managed properly.
Formula:C24H20N2O2
InChI:InChI=1/C24H20N2O2/c25-19-5-13-23(14-6-19)27-21-9-1-17(2-10-21)18-3-11-22(12-4-18)28-24-15-7-20(26)8-16-24/h1-16H,25-26H2
SMILES:c1cc(ccc1c1ccc(cc1)Oc1ccc(cc1)N)Oc1ccc(cc1)N
Synonyms:
  • 4,4-Bis(4-aminophenoxy)biphenyl
  • 4-4'-Bis(4-aminophenoxy)biphenyl
  • 4,4'-[Biphenyl-4,4'-Diylbis(Oxy)]Dianiline
  • Bapb
  • 4,4'-Bis(4-aminophenoxy)biphenyl(BAPB)
Sort by
Found 5 products.