CymitQuimica logo

CAS 13081-19-1

:

3,3,3-Trifluoro-N,N-dimethyl-2-oxopropanamide

Description:
3,3,3-Trifluoro-N,N-dimethyl-2-oxopropanamide, with the CAS number 13081-19-1, is a chemical compound characterized by its trifluoromethyl group and amide functional group. This substance is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits high thermal stability and is soluble in polar organic solvents, making it useful in various chemical applications. The presence of trifluoromethyl groups imparts unique electronic properties, enhancing its reactivity and potential as a building block in organic synthesis. Additionally, the dimethylamide moiety contributes to its basicity and nucleophilicity, allowing it to participate in various chemical reactions, including acylation and amidation. Due to its fluorinated structure, it may also exhibit distinct biological activity, which can be of interest in pharmaceutical research. Safety data should be consulted for handling and exposure guidelines, as fluorinated compounds can have specific environmental and health considerations.
Formula:C5H6F3NO2
InChI:InChI=1S/C5H6F3NO2/c1-9(2)4(11)3(10)5(6,7)8/h1-2H3
InChI key:InChIKey=ZFZKETXKTSGYIM-UHFFFAOYSA-N
SMILES:C(C(N(C)C)=O)(C(F)(F)F)=O
Synonyms:
  • Pyruvamide, 3,3,3-trifluoro-N,N-dimethyl-
  • 3,3,3-Trifluoro-N,N-dimethyl-2-oxopropanamide
  • Propanamide, 3,3,3-trifluoro-N,N-dimethyl-2-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.