CymitQuimica logo

CAS 13082-48-9

:

[1,1'-biphenyl]-4,4'-diyl bis(2-methylacrylate)

Description:
[1,1'-Biphenyl]-4,4'-diyl bis(2-methylacrylate), with the CAS number 13082-48-9, is an organic compound characterized by its structure, which features two 2-methylacrylate groups attached to a biphenyl backbone. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It exhibits properties such as good thermal stability and reactivity, making it useful in various applications, including as a monomer in polymer chemistry and in the production of coatings and adhesives. The presence of the acrylate functional groups allows for polymerization under UV light or heat, facilitating the formation of cross-linked networks. Additionally, this compound may demonstrate moderate solubility in organic solvents, while being less soluble in water. Its chemical behavior is influenced by the biphenyl structure, which can provide rigidity and enhance the mechanical properties of the resulting polymers. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C20H18O4
InChI:InChI=1S/C20H18O4/c1-13(2)19(21)23-17-9-5-15(6-10-17)16-7-11-18(12-8-16)24-20(22)14(3)4/h5-12H,1,3H2,2,4H3
InChI key:HVTJQICZTQZLSK-UHFFFAOYSA-N
SMILES:CC(=C)C(=O)OC1=CC=C(C=C1)C2=CC=C(C=C2)OC(=O)C(=C)C
Synonyms:
  • [1,1'-biphenyl]-4,4'-diylbis(2-methacrylate)
  • 2-Propenoic acid, 2-methyl-, [1,1'-biphenyl]-4,4'-diyl ester
  • 1,1-biphenyl]-4,4-diyl bis(2-Methylacrylate)
  • 4,4'-Biphenylene Methacrylate
Found 3 products.