CAS 13083-41-5
:2,3-dihydro-1H-indol-3-ylacetato
Description:
2,3-Dihydro-1H-indol-3-ylacetato, with the CAS number 13083-41-5, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by the presence of an acetate group attached to the nitrogen of the indole, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in organic solvents, which makes it useful in various chemical applications. The indole moiety is known for its significance in medicinal chemistry, often exhibiting various pharmacological properties, including anti-inflammatory and neuroprotective effects. The compound may also participate in various chemical reactions, such as esterification and acylation, due to the presence of the acetate group. Its unique structure and properties make it a subject of interest in research, particularly in the fields of organic synthesis and drug development.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,7,11H,5-6H2,(H,12,13)
SMILES:c1ccc2c(c1)C(CC(=O)O)CN2
Synonyms:- 1H-indole-3-acetic acid, 2,3-dihydro-
- 2,3-Dihydro-1H-indol-3-ylacetic acid
- 3-Indole acetic acid (IAA)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
