CAS 1308319-49-4

4-Isoxazolesulfonamide, N-[(1-aminocyclohexyl)methyl]-3,5-dimethyl-, hydrochloride (1:1)

Description:

4-Isoxazolesulfonamide, N-[(1-aminocyclohexyl)methyl]-3,5-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its isoxazole ring structure, which contributes to its biological activity. This compound features a sulfonamide functional group, enhancing its potential as a pharmacological agent. The presence of the N-[(1-aminocyclohexyl)methyl] moiety suggests that it may interact with biological targets, possibly influencing neurotransmitter systems or exhibiting antimicrobial properties. The hydrochloride form indicates that it is a salt, which can enhance solubility and stability in aqueous environments, making it suitable for pharmaceutical applications. Its molecular structure includes multiple methyl groups, which can affect its lipophilicity and overall pharmacokinetic profile. As with many sulfonamides, this compound may exhibit a range of biological activities, including antibacterial or anti-inflammatory effects, although specific activities would depend on further empirical studies. Safety and handling precautions are essential, as with all chemical substances, particularly those with potential pharmacological effects.

Formula: C₁₂H₂₁N₃O₃S·ClH

InChI: InChI=1S/C12H21N3O3S.ClH/c1-9-11(10(2)18-15-9)19(16,17)14-8-12(13)6-4-3-5-7-12;/h14H,3-8,13H2,1-2H3;1H

InChI key: InChIKey=QONOARJHCBAILD-UHFFFAOYSA-N

SMILES: S(NCC1(N)CCCCC1)(=O)(=O)C=2C(C)=NOC2C.Cl

Synonyms:

• 4-Isoxazolesulfonamide, N-[(1-aminocyclohexyl)methyl]-3,5-dimethyl-, hydrochloride (1:1)

N-[(1-Aminocyclohexyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide hydrochloride

CAS: 1308319-49-4

Versatile small molecule scaffold

Formula: C₁₂H₂₂ClN₃O₃S

Purity: Min. 95%

Molecular weight: 323.84 g/mol

Ref: 3D-ICC31949