CAS 1308319-50-7

2-Furanmethanamine, α-2-furanyl-, hydrochloride (1:1)

Description:

2-Furanmethanamine, α-2-furanyl-, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which contributes to its aromatic properties and potential reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amine functional group suggests that it may participate in hydrogen bonding, influencing its interactions with biological systems. This compound may exhibit biological activity, potentially acting as a precursor or intermediate in the synthesis of more complex molecules. Its molecular structure allows for various substitution reactions, making it a versatile building block in organic synthesis. Safety data and handling precautions should be observed, as with any chemical, to mitigate risks associated with its use. Overall, 2-Furanmethanamine, α-2-furanyl-, hydrochloride is of interest in both research and industrial contexts, particularly in the development of new therapeutic agents.

Formula: C₉H₉NO₂·ClH

InChI: InChI=1S/C9H9NO2.ClH/c10-9(7-3-1-5-11-7)8-4-2-6-12-8;/h1-6,9H,10H2;1H

InChI key: InChIKey=KGMRBXLSIJHPJR-UHFFFAOYSA-N

SMILES: C(N)(C1=CC=CO1)C2=CC=CO2.Cl

Synonyms:

• 2-Furanmethanamine, α-2-furanyl-, hydrochloride (1:1)