CAS 130835-20-0
:4,4-difluoroglutamic acid
Description:
4,4-Difluoroglutamic acid is a fluorinated derivative of glutamic acid, characterized by the presence of two fluorine atoms at the 4-position of the carbon chain. This compound is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation but can play significant roles in biochemical pathways. It is typically a white crystalline solid and is soluble in water due to the presence of the carboxylic acid functional groups. The introduction of fluorine atoms can influence the compound's biological activity, stability, and interaction with enzymes or receptors. 4,4-Difluoroglutamic acid is of interest in medicinal chemistry and research, particularly in studies related to neurotransmission and metabolic pathways. Its unique properties may also make it a valuable tool in the development of pharmaceuticals or as a biochemical probe. As with many fluorinated compounds, it is essential to handle it with care, considering potential toxicity and environmental impact.
Formula:C5H7F2NO4
InChI:InChI=1/C5H7F2NO4/c6-5(7,4(11)12)1-2(8)3(9)10/h2H,1,8H2,(H,9,10)(H,11,12)
SMILES:C(C(C(=O)O)N)C(C(=O)O)(F)F
Synonyms:- 4,4-Difluoro-L-glutamic acid
- 4,4-F(2)Glu
- 4,4-F2Glu
- L-Glutamic acid, 4,4-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
