CymitQuimica logo

CAS 1308384-31-7

:

1,1-Dimethylethyl 3-(aminomethyl)-3-hydroxy-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 3-(aminomethyl)-3-hydroxy-1-piperidinecarboxylate, identified by its CAS number 1308384-31-7, is a chemical compound that features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, as well as an aminomethyl group and a hydroxy group that are attached to the piperidine structure. The carboxylate functionality indicates that it is an ester, which can influence its solubility and reactivity. The presence of both amino and hydroxy groups suggests potential for hydrogen bonding, which may affect its physical properties such as boiling point and solubility in polar solvents. Additionally, the compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Overall, its unique combination of functional groups and structural characteristics positions it as a compound of potential significance in various chemical and pharmaceutical applications.
Formula:C11H22N2O3
InChI:InChI=1S/C11H22N2O3/c1-10(2,3)16-9(14)13-6-4-5-11(15,7-12)8-13/h15H,4-8,12H2,1-3H3
InChI key:InChIKey=RXAPIVVEFHXCTQ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(CN)(O)CCC1
Synonyms:
  • 1-Piperidinecarboxylic acid, 3-(aminomethyl)-3-hydroxy-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 3-(aminomethyl)-3-hydroxy-1-piperidinecarboxylate
  • 1-Boc-3-aMinoMethyl-3-hyd...
  • 1-Boc-3-aMinoMethyl-3-hydroxypiperidine
  • 3-(Aminomethyl)-1-Boc-piperidin-3-ol
Found 5 products.