CAS 1308384-44-2

2-Methyl-2,8-diazaspiro[5.5]undecan-3-one

Description:

2-Methyl-2,8-diazaspiro[5.5]undecan-3-one is a chemical compound characterized by its unique spirocyclic structure, which features a combination of nitrogen atoms and a ketone functional group. The presence of two nitrogen atoms in the spiro framework contributes to its potential biological activity and makes it of interest in medicinal chemistry. The compound's molecular structure includes a bicyclic system that can influence its physical and chemical properties, such as solubility and reactivity. Typically, compounds with such structures may exhibit interesting pharmacological properties, including potential use as pharmaceuticals or in other applications. The presence of the methyl group can also affect the compound's steric and electronic properties, influencing its interactions with biological targets. As with many nitrogen-containing heterocycles, 2-Methyl-2,8-diazaspiro[5.5]undecan-3-one may participate in various chemical reactions, making it a subject of interest for further research in synthetic and medicinal chemistry.

Formula: C₁₀H₁₈N₂O

InChI: InChI=1S/C10H18N2O/c1-12-8-10(5-3-9(12)13)4-2-6-11-7-10/h11H,2-8H2,1H3

InChI key: InChIKey=RPWQHZNDVNXJHW-UHFFFAOYSA-N

SMILES: CN1CC2(CCC1=O)CCCNC2

Synonyms:

• 2-Methyl-2,8-diazaspiro[5.5]undecan-3-one
• 2,8-Diazaspiro[5.5]undecan-3-one, 2-methyl-

2-methyl-2,8-diazaspiro[5.5]undecan-3-one dihydrochloride hydrate

CAS: 1308384-44-2

Formula: C₁₀H₂₂Cl₂N₂O₂

Purity: 95.0%

Molecular weight: 273.2

Ref: 10-F360578