CAS 1308384-49-7

rel-(3R,4R)-4-(Dimethylamino)-3-piperidinol

Description:

Rel-(3R,4R)-4-(Dimethylamino)-3-piperidinol is a chemical compound characterized by its piperidine structure, which includes a piperidinol moiety with a dimethylamino group at the 4-position. This compound typically exhibits properties associated with tertiary amines, such as basicity and the ability to form hydrogen bonds due to the presence of the hydroxyl group. The stereochemistry indicated by the (3R,4R) configuration suggests specific spatial arrangements of the substituents, which can influence its biological activity and interactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential role as a building block or active ingredient. Its solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure. As with many organic compounds, safety and handling precautions are essential, particularly when dealing with amines and alcohols, which can be sensitive to environmental conditions.

Formula: C₇H₁₆N₂O

InChI: InChI=1/C7H16N2O/c1-9(2)6-3-4-8-5-7(6)10/h6-8,10H,3-5H2,1-2H3/t6-,7-/s2

InChI key: InChIKey=ASJQOSZDBAQHIA-WZTWBHKBNA-N

SMILES: N(C)(C)[C@@H]1[C@@H](O)CNCC1

Synonyms:

• 3-Piperidinol, 4-(dimethylamino)-, (3R,4R)-rel-
• rel-(3R,4R)-4-(Dimethylamino)-3-piperidinol