CymitQuimica logo

CAS 1308384-57-7

:

3-Methyl-1-oxa-3,7-diazaspiro[4.4]nonan-2-one

Description:
3-Methyl-1-oxa-3,7-diazaspiro[4.4]nonan-2-one is a heterocyclic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen atoms within its framework. The presence of the spiro system indicates that the molecule contains two rings that share a single atom, contributing to its rigidity and potential biological activity. The "3-methyl" designation suggests the presence of a methyl group at the third carbon position, which can influence the compound's reactivity and solubility. The compound's diaza configuration indicates that it contains two nitrogen atoms, which may participate in hydrogen bonding and affect its interaction with biological targets. Additionally, the presence of a carbonyl group (as indicated by "2-one") suggests potential reactivity in nucleophilic addition reactions. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and spectral data, would require further investigation through experimental methods.
Formula:C7H12N2O2
InChI:InChI=1S/C7H12N2O2/c1-9-5-7(11-6(9)10)2-3-8-4-7/h8H,2-5H2,1H3
InChI key:InChIKey=AHPCMZJMUHLTAO-UHFFFAOYSA-N
SMILES:CN1CC2(OC1=O)CCNC2
Synonyms:
  • 3-Methyl-1-oxa-3,7-diazaspiro[4.4]nonan-2-one
  • 1-Oxa-3,7-diazaspiro[4.4]nonan-2-one, 3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.