CAS 13084-13-4
:2-Thiazolidinecarboxylicacid,2-methyl-(6CI,7CI,8CI,9CI)
Description:
2-Thiazolidinecarboxylic acid, 2-methyl- (CAS 13084-13-4) is a heterocyclic organic compound characterized by a five-membered ring containing both sulfur and nitrogen atoms. This compound features a thiazolidine structure, which is a saturated ring with a carboxylic acid functional group and a methyl substituent at the second carbon position. The presence of the thiazolidine ring imparts unique chemical properties, including potential reactivity in various organic synthesis reactions. It is generally soluble in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting metabolic disorders. Its structural characteristics allow for potential modifications that can enhance its efficacy or selectivity in biological applications. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C5H9NO2S
InChI:InChI=1/C5H9NO2S/c1-5(4(7)8)6-2-3-9-5/h6H,2-3H2,1H3,(H,7,8)
Synonyms:- 2-methyl-1,3-thiazolidine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
