
CAS 130840-22-1
:4-(4-Bromobutoxy)benzenesulfonamide
Description:
4-(4-Bromobutoxy)benzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the bromobutoxy group indicates that it has a bromine atom attached to a butyl chain, which is further connected to a benzene ring. This structure contributes to its hydrophobic characteristics, while the sulfonamide group enhances its solubility in polar solvents. The compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular interactions can be influenced by the bromine substituent, which can participate in various chemical reactions, including nucleophilic substitutions. Additionally, the sulfonamide moiety can engage in hydrogen bonding, affecting its biological activity and potential applications in pharmaceuticals. Overall, 4-(4-Bromobutoxy)benzenesulfonamide is of interest in medicinal chemistry, particularly for its potential use in drug development and as a building block for more complex molecules.
Formula:C10H14BrNO3S
InChI:InChI=1S/C10H14BrNO3S/c11-7-1-2-8-15-9-3-5-10(6-4-9)16(12,13)14/h3-6H,1-2,7-8H2,(H2,12,13,14)
InChI key:InChIKey=IWECJQRTGYPRJX-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC=C(OCCCCBr)C=C1
Synonyms:- Benzenesulfonamide, 4-(4-bromobutoxy)-
- 4-(4-Bromobutoxy)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.