CAS 130848-06-5: Decursinol angelate
Description:Decursinol angelate is a chemical compound classified as a natural product, specifically a type of coumarin derivative. It is primarily derived from plants in the Apiaceae family, particularly from the roots of Angelica gigas. This compound is characterized by its unique structure, which includes a decursinol moiety and an angelate ester group. Decursinol angelate exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its solubility is generally moderate in organic solvents, and it may have limited solubility in water. The compound's stability can be influenced by environmental factors such as light and temperature. As with many natural products, its extraction and purification can be complex, often requiring specific methods to isolate it from plant matrices. Overall, decursinol angelate represents a fascinating area of study within natural product chemistry, with potential applications in medicine and health.
Formula:C19H20O5
InChI:InChI=1S/C19H20O5/c1-5-11(2)18(21)23-16-9-13-8-12-6-7-17(20)22-14(12)10-15(13)24-19(16,3)4/h5-8,10,16H,9H2,1-4H3/b11-5-/t16-/m0/s1
InChI key:InChIKey=AGABNGOXUSXQDD-XKGFZTIGSA-N
SMILES:O=C1OC=2C=C3OC(C)(C)C(OC(=O)C(=CC)C)CC3=CC2C=C1
- Synonyms:
- 2-Butenoic acid, 2-methyl-, (7S)-7,8-dihydro-8,8-dimethyl-2-oxo-2H,6H-benzo[1,2-b:5,4-b′]dipyran-7-yl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, 7,8-dihydro-8,8-dimethyl-2-oxo-2H,6H-benzo[1,2-b:5,4-b′]dipyran-7-yl ester, [S-(Z)]-
- 2-Butenoicacid, 2-methyl-, 7,8-dihydro-8,8-dimethyl-2-oxo-2H,6H-benzo[1,2-b:5,4-b']dipyran-7-ylester, [S-(Z)]-
- 2H,6H-Benzo[1,2-b:5,4-b']dipyran, 2-butenoic acid deriv.
- Acutilobin
- Decursinol angelate
