
CAS 13085-08-0
:Mazipredone
Description:
Mazipredone, with the CAS number 13085-08-0, is a synthetic corticosteroid that exhibits anti-inflammatory and immunosuppressive properties. It is structurally related to prednisolone and is designed to enhance therapeutic effects while minimizing side effects. Mazipredone is characterized by its ability to modulate the immune response, making it useful in treating various inflammatory conditions and autoimmune disorders. The compound functions by binding to glucocorticoid receptors, leading to the regulation of gene expression involved in inflammation and immune response. Its pharmacological profile includes a relatively rapid onset of action and a favorable safety margin compared to traditional corticosteroids. However, like other corticosteroids, it may be associated with potential side effects, including metabolic changes and effects on the endocrine system. Due to its specific properties, Mazipredone is of interest in both clinical and research settings, particularly in the development of therapies for conditions requiring potent anti-inflammatory interventions.
Formula:C26H38N2O4
InChI:InChI=1S/C26H38N2O4/c1-24-8-6-18(29)14-17(24)4-5-19-20-7-9-26(32,25(20,2)15-21(30)23(19)24)22(31)16-28-12-10-27(3)11-13-28/h6,8,14,19-21,23,30,32H,4-5,7,9-13,15-16H2,1-3H3/t19-,20-,21-,23+,24-,25-,26-/m0/s1
InChI key:InChIKey=CZBOZZDZNVIXFC-VRRJBYJJSA-N
SMILES:C[C@@]12[C@]([C@]3([C@]([C@@H](O)C1)([C@]4(C)C(CC3)=CC(=O)C=C4)[H])[H])(CC[C@@]2(C(CN5CCN(C)CC5)=O)O)[H]
Synonyms:- 21-Deoxy-21-(N-methylpiperazinyl)prednisolone
- 11β,17α-hydroxy-3,20-dioxo-21-(4-methyl-1-piperazinyl)-1,4-pregnadiene
- Pregna-1,4-diene-3,20-dione, 11,17-dihydroxy-21-(4-methyl-1-piperazinyl)-, (11β)-
- (11β)-11,17-Dihydroxy-21-(4-methyl-1-piperazinyl)pregna-1,4-diene-3,20-dione
- Pregna-1,4-diene-3,20-dione, 11β,17-dihydroxy-21-(4-methyl-1-piperazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mazipredone
CAS:<p>Mazipredone is a water-soluble, long-acting prednisolone derivative used topically for skin conditions &amp; parenterally as a glucocorticoid.</p>Formula:C26H38N2O4Color and Shape:SolidMolecular weight:442.59
