CAS 130859-46-0
:9-(trideuteriomethyl)purin-6-amine
Description:
9-(Trideuteriomethyl)purin-6-amine is a deuterated derivative of purine, specifically modified at the 9-position with a trideuteriomethyl group. This compound retains the core purine structure, which consists of a fused imidazole and pyrimidine ring, making it a heterocyclic aromatic compound. The presence of deuterium, a stable isotope of hydrogen, enhances its utility in various applications, particularly in NMR spectroscopy and metabolic studies, as it can provide insights into molecular dynamics and interactions without altering the chemical behavior significantly. The amine functional group at the 6-position contributes to its reactivity and potential interactions in biological systems. As a research chemical, it may be used in studies related to nucleic acids, drug development, or as a tracer in metabolic pathways. Its unique isotopic labeling allows for precise tracking in complex biological environments, making it valuable in both biochemical and pharmaceutical research.
Formula:C6H4D3N5
InChI:InChI=1/C6H7N5/c1-11-3-10-4-5(7)8-2-9-6(4)11/h2-3H,1H3,(H2,7,8,9)/i1D3
SMILES:C(n1cnc2c(N)ncnc12)([2H])([2H])[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
9-Methyl Adenine-d3
CAS:Controlled ProductApplications Labelled receptor adenine derivative binding membrane brain animal cell line.
References Camaioni, E., et al.: Bioorg. Med. Chem., 6, 523 (1998), Kelly, M., et al.: Br. J. Pharmacol., 125, 979 (1998), Redzic, Z., et al.: Brain Res., 888, 66 (2001), Levy, D., et al.: J. Med. Chem., 46, 2177 (2003),Formula:C62H3H4N5Color and Shape:NeatMolecular weight:152.179H-Purin-6-amine, 9-(methyl-d3)- (9CI)
CAS:Formula:C6H4D3N5Color and Shape:SolidMolecular weight:152.1718

