CAS 1308650-20-5

Thieno[3,2-b]thiophene-2-carboxylic acid, 3-(aminomethyl)-, ethyl ester, hydrochloride (1:1)

Description:

Thieno[3,2-b]thiophene-2-carboxylic acid, 3-(aminomethyl)-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique heterocyclic structure, which incorporates both thieno and thiophene rings. This compound features a carboxylic acid functional group, an ethyl ester moiety, and an aminomethyl substituent, contributing to its potential reactivity and solubility properties. The hydrochloride salt form indicates that it is a protonated version of the base compound, enhancing its stability and solubility in aqueous environments. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for pharmaceutical applications. Its molecular interactions can be influenced by the presence of the amino group, which can participate in hydrogen bonding and other interactions. Additionally, the thieno and thiophene rings may contribute to electronic properties that are valuable in organic electronics or materials science. Overall, this compound's unique structure and functional groups suggest a range of potential applications in medicinal chemistry and materials development.

Formula: C₁₀H₁₁NO₂S₂·ClH

InChI: InChI=1S/C10H11NO2S2.ClH/c1-2-13-10(12)9-6(5-11)8-7(15-9)3-4-14-8;/h3-4H,2,5,11H2,1H3;1H

InChI key: InChIKey=RYOMVZKDHFHCFW-UHFFFAOYSA-N

SMILES: C(N)C=1C2=C(SC1C(OCC)=O)C=CS2.Cl

Synonyms:

• Thieno[3,2-b]thiophene-2-carboxylic acid, 3-(aminomethyl)-, ethyl ester, hydrochloride (1:1)
• Ethyl 3-(aminomethyl)thieno[4,5-b]thiophene-2-carboxylate hydrochloride

Ethyl 3-(aminomethyl)thieno[3,2-b]thiophene-2-carboxylate hydrochloride

CAS: 1308650-20-5

Versatile small molecule scaffold

Formula: C₁₀H₁₂ClNO₂S₂

Purity: Min. 95%

Molecular weight: 277.8 g/mol

Ref: 3D-ICC65020