CAS 1308650-39-6

2-Thiazoleethanamine, 4-(2-pyridinyl)-, hydrochloride (1:2)

Description:

2-Thiazoleethanamine, 4-(2-pyridinyl)-, hydrochloride (1:2) is a chemical compound characterized by its thiazole and pyridine functional groups, which contribute to its potential biological activity. The presence of the thiazole ring suggests that it may exhibit properties typical of heterocyclic compounds, such as antimicrobial or antifungal activities. The pyridine moiety can enhance its solubility and reactivity, making it useful in various chemical reactions or as a ligand in coordination chemistry. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. However, specific properties such as melting point, solubility, and reactivity would require empirical data for precise characterization. Overall, this compound's unique structural features position it as a candidate for further research in drug development and other chemical applications.

Formula: C₁₀H₁₁N₃S·2ClH

InChI: InChI=1S/C10H11N3S.2ClH/c11-5-4-10-13-9(7-14-10)8-3-1-2-6-12-8;;/h1-3,6-7H,4-5,11H2;2*1H

InChI key: InChIKey=PQNAOIYTIWTUAB-UHFFFAOYSA-N

SMILES: C(CN)C1=NC(=CS1)C2=CC=CC=N2.Cl

Synonyms:

• 2-Thiazoleethanamine, 4-(2-pyridinyl)-, hydrochloride (1:2)

2-[4-(Pyridin-2-yl)-1,3-thiazol-2-yl]ethan-1-amine dihydrochloride

CAS: 1308650-39-6

Versatile small molecule scaffold

Formula: C₁₀H₁₃Cl₂N₃S

Purity: Min. 95%

Molecular weight: 278.2 g/mol

Ref: 3D-ICC65039