
CAS 1308650-42-1
:(αR)-α,1-Dimethyl-4-piperidinemethanamine
Description:
(αR)-α,1-Dimethyl-4-piperidinemethanamine, identified by its CAS number 1308650-42-1, is a chemical compound characterized by its piperidine structure, which includes a nitrogen atom within a six-membered ring. This compound features two methyl groups attached to the alpha carbon and a methanamine group, contributing to its unique properties. It is typically classified as an amine, which influences its reactivity and interactions with other substances. The stereochemistry indicated by the (αR) designation suggests a specific spatial arrangement of atoms, which can affect the compound's biological activity and pharmacological profile. Such compounds may exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. The presence of the piperidine ring often imparts characteristics such as increased lipophilicity, which can enhance membrane permeability. However, detailed information regarding its specific physical and chemical properties, such as solubility, boiling point, and reactivity, would require further empirical data or literature references.
Formula:C8H18N2
InChI:InChI=1S/C8H18N2/c1-7(9)8-3-5-10(2)6-4-8/h7-8H,3-6,9H2,1-2H3/t7-/m1/s1
InChI key:InChIKey=YYBLKINSGHLYAR-SSDOTTSWSA-N
SMILES:[C@H](C)(N)C1CCN(C)CC1
Synonyms:- 4-Piperidinemethanamine, α,1-dimethyl-, (αR)-
- (αR)-α,1-Dimethyl-4-piperidinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.