CAS 1308650-55-6

1,1-Dimethylethyl 4-[(2S)-2-pyrrolidinylcarbonyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[(2S)-2-pyrrolidinylcarbonyl]-1-piperazinecarboxylate, with the CAS number 1308650-55-6, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with both amides and esters due to the presence of the carbonyl groups. It is likely to be a solid or liquid at room temperature, depending on its specific formulation and purity. The presence of the dimethyl group contributes to its steric hindrance, which can influence its reactivity and interaction with biological targets. This compound may have potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can facilitate interactions with biological receptors. Additionally, its solubility and stability in various solvents can vary, impacting its usability in different chemical environments. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₄H₂₅N₃O₃

InChI: InChI=1S/C14H25N3O3/c1-14(2,3)20-13(19)17-9-7-16(8-10-17)12(18)11-5-4-6-15-11/h11,15H,4-10H2,1-3H3/t11-/m0/s1

InChI key: InChIKey=MUWOCYONAOKDIN-NSHDSACASA-N

SMILES: C(=O)(N1CCN(C(OC(C)(C)C)=O)CC1)[C@@H]2CCCN2

Synonyms:

• 1,1-Dimethylethyl 4-[(2S)-2-pyrrolidinylcarbonyl]-1-piperazinecarboxylate
• 1-Piperazinecarboxylic acid, 4-[(2S)-2-pyrrolidinylcarbonyl]-, 1,1-dimethylethyl ester

tert-Butyl 4-[(2S)-pyrrolidine-2-carbonyl]piperazine-1-carboxylate

CAS: 1308650-55-6

Versatile small molecule scaffold

Formula: C₁₄H₂₅N₃O₃

Purity: Min. 95%

Molecular weight: 283.37 g/mol

Ref: 3D-ICC65055