CymitQuimica logo

CAS 130874-32-7

:

4-bromo-3,5-dimethyl-1-(phenylsulfonyl)-1H-pyrazole

Description:
4-Bromo-3,5-dimethyl-1-(phenylsulfonyl)-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and two methyl groups at the 3 and 5 positions contributes to its unique reactivity and solubility properties. The phenylsulfonyl group attached to the 1-position enhances its potential for various chemical reactions, particularly in the context of medicinal chemistry, where such modifications can influence biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The presence of the sulfonyl group can also impart specific electronic properties, making it a candidate for further functionalization or as a ligand in coordination chemistry. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.
Formula:C11H11BrN2O2S
InChI:InChI=1/C11H11BrN2O2S/c1-8-11(12)9(2)14(13-8)17(15,16)10-6-4-3-5-7-10/h3-7H,1-2H3
SMILES:Cc1c(c(C)n(n1)S(=O)(=O)c1ccccc1)Br
Synonyms:
  • 1H-pyrazole, 4-bromo-3,5-dimethyl-1-(phenylsulfonyl)-
  • 4-Bromo-3,5-dimethyl-1-(phenylsulfonyl)-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.