
CAS 130879-38-8
:Ethyl 2-chloro-6-cyano-3-pyridinecarboxylate
Description:
Ethyl 2-chloro-6-cyano-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a cyano group (-CN) and a chloro substituent (-Cl) on the pyridine ring, as well as an ethyl ester functional group. The presence of the cyano group contributes to its potential reactivity, making it useful in various synthetic applications, particularly in the field of medicinal chemistry. The chloro substituent can serve as a site for further chemical modifications, enhancing its versatility in organic synthesis. Ethyl 2-chloro-6-cyano-3-pyridinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which facilitates its use in various chemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive functional groups. Overall, its unique structure and functional groups make it a valuable compound in chemical research and development.
Formula:C9H7ClN2O2
InChI:InChI=1S/C9H7ClN2O2/c1-2-14-9(13)7-4-3-6(5-11)12-8(7)10/h3-4H,2H2,1H3
InChI key:InChIKey=SBFJUTOYKJJKLV-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(Cl)N=C(C#N)C=C1
Synonyms:- Ethyl 2-chloro-6-cyano-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 2-chloro-6-cyano-, ethyl ester
- 2-Chloro-6-cyano-nicotinic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.