
CAS 1308814-99-4
:Ethyl 1-(4-aminophenyl)cyclopropanecarboxylate
Description:
Ethyl 1-(4-aminophenyl)cyclopropanecarboxylate is an organic compound characterized by its unique cyclopropane structure, which is a three-membered carbon ring. This compound features an ethyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of a 4-aminophenyl group indicates that it has an amino group (-NH2) attached to a phenyl ring, which can influence its biological activity and potential applications in pharmaceuticals. The cyclopropanecarboxylate moiety suggests that it may exhibit interesting chemical properties, such as the ability to undergo various reactions typical of esters and amines. Additionally, the compound's molecular structure may impart specific steric and electronic characteristics, making it a candidate for further study in medicinal chemistry or as a building block in organic synthesis. Its CAS number, 1308814-99-4, allows for precise identification in chemical databases, facilitating research and development efforts involving this compound.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2/c1-2-15-11(14)12(7-8-12)9-3-5-10(13)6-4-9/h3-6H,2,7-8,13H2,1H3
InChI key:InChIKey=BVVLSEKWJFNCEJ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1(CC1)C2=CC=C(N)C=C2
Synonyms:- Ethyl 1-(4-aminophenyl)cyclopropanecarboxylate
- Cyclopropanecarboxylic acid, 1-(4-aminophenyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.