CAS 130887-16-0
:3-(2,4,5-TRIFLUORO-PHENYL)-PROPAN-1-OL
Description:
3-(2,4,5-Trifluoro-phenyl)-propan-1-ol, with the CAS number 130887-16-0, is an organic compound characterized by its structure, which includes a propanol backbone substituted with a trifluorophenyl group. This compound features three fluorine atoms attached to the phenyl ring, significantly influencing its chemical properties, such as increased lipophilicity and altered reactivity. The presence of the hydroxyl (-OH) group in the propanol portion contributes to its potential as a polar compound, enhancing its solubility in polar solvents and affecting its hydrogen bonding capabilities. The trifluoromethyl groups can also impart unique electronic properties, making this compound of interest in various fields, including pharmaceuticals and agrochemicals. Its synthesis and applications may involve considerations of its stability, reactivity, and interactions with biological systems, particularly due to the presence of the trifluoromethyl substituents, which can modulate biological activity. Overall, this compound exemplifies the intersection of fluorinated organic chemistry and functional group chemistry.
Formula:C9H9F3O
InChI:InChI=1/C9H9F3O/c10-7-5-9(12)8(11)4-6(7)2-1-3-13/h4-5,13H,1-3H2
SMILES:C(Cc1cc(c(cc1F)F)F)CO
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
