CAS 13089-26-4
:β-D-Glucopyranoside, 2-nitrophenyl 2-(acetylamino)-2-deoxy-, 3,4,6-triacetate
Description:
β-D-Glucopyranoside, 2-nitrophenyl 2-(acetylamino)-2-deoxy-, 3,4,6-triacetate, commonly referred to as a glycoside, is a chemical compound characterized by its structure, which includes a glucopyranoside moiety linked to a 2-nitrophenyl group and multiple acetyl groups. This compound is typically used in biochemical research and synthetic organic chemistry due to its ability to serve as a substrate for various enzymatic reactions, particularly in studies involving glycosidases. The presence of the acetyl groups enhances its solubility and stability, while the nitrophenyl group can act as a chromophore, allowing for spectroscopic analysis. Its molecular structure contributes to its reactivity and interaction with biological systems, making it a valuable tool in the study of carbohydrate chemistry and enzyme kinetics. Additionally, the compound's properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions under which it is handled. Safety data should be consulted to ensure proper handling and usage in laboratory settings.
Formula:C20H24N2O11
InChI:InChI=1S/C20H24N2O11/c1-10(23)21-17-19(31-13(4)26)18(30-12(3)25)16(9-29-11(2)24)33-20(17)32-15-8-6-5-7-14(15)22(27)28/h5-8,16-20H,9H2,1-4H3,(H,21,23)/t16-,17-,18-,19-,20-/m1/s1
InChI key:InChIKey=HANQNSOXWBEEGZ-LASHMREHSA-N
SMILES:O(C(C)=O)[C@@H]1[C@@H](NC(C)=O)[C@H](OC2=C(N(=O)=O)C=CC=C2)O[C@H](COC(C)=O)[C@H]1OC(C)=O
Synonyms:- (2'-Nitro)Phenyl-2-Acetamido-3,4,6-Tri-O-Acetyl-2-Deoxy-Ss-D-Glucopyranoside
- 2-Nitrophenyl2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside
- Glucopyranoside, o-nitrophenyl 2-acetamido-2-deoxy-, triacetate
- Glucopyranoside, o-nitrophenyl 2-acetamido-2-deoxy-, triacetate (ester), β-<span class="text-smallcaps">D</span>-
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, 2-nitrophenyl 2-(acetylamino)-2-deoxy-, 3,4,6-triacetate
- β-<span class="text-smallcaps">D</span>-Glucoside, o-nitrophenyl 2-acetamido-2-deoxy-, triacetate
- Glucopyranoside, o-nitrophenyl 2-acetamido-2-deoxy-, triacetate (ester), β-D-
- β-D-Glucoside, o-nitrophenyl 2-acetamido-2-deoxy-, triacetate
- β-D-Glucopyranoside, 2-nitrophenyl 2-(acetylamino)-2-deoxy-, 3,4,6-triacetate
- o-Nitrophenyl 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-galactopyranoside
- 2-Nitrophenyl 2-(acetylaMino)-2-deoxy-β-D-glucopyranoside 3,4,6-Triacetate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Nitrophenyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside
CAS:2-Nitrophenyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside is a chromogenic substrate used to detect and measure the activity of glycosidase enzymes. Glycosidases are enzymes that hydrolyze glycosidic bonds in carbohydrates, and are produced by many organisms. The substrate is cleaved by glycosidase to release a chromophore, which can be quantified via spectrophotometry analysis. 2-Nitrophenyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside is widely used in various applications, including enzyme kinetics studies, inhibitor screening, and the detection of NAGase activity in biological samples, such as serum, urine, and cell lysates. It is also used for the identification and characterization of glycosidases in microorganisms and the study of glycosylation-related processes in cells and tissues.Purity:Min. 95%Molecular weight:468.41 g/mol

