CAS 13089-27-5
:(4'-NITRO)PHENYL-2-ACETAMIDO-3,4,6-TRI-O-ACETYL-2-DEOXY-BETA-D-GLUCOPYRANOSIDE
Description:
(4'-Nitrophenyl)-2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-beta-D-glucopyranoside is a complex organic compound characterized by its structural features, which include a glucopyranoside backbone modified with acetyl groups and a nitrophenyl substituent. This compound is typically used in biochemical research, particularly in studies involving glycosylation reactions and enzyme activity. The presence of the nitro group enhances its reactivity, making it a useful substrate for various chemical transformations. The acetyl groups serve to protect hydroxyl functionalities, facilitating selective reactions. As a derivative of glucosamine, it exhibits properties typical of carbohydrates, such as solubility in polar solvents and potential interactions with biological macromolecules. Its molecular structure contributes to its role in synthetic organic chemistry and potential applications in medicinal chemistry, particularly in the development of glycosylated compounds. Safety data should be consulted, as nitro compounds can be hazardous, and appropriate handling procedures should be followed in laboratory settings.
Formula:C20H24N2O11
InChI:InChI=1/C20H24N2O11/c1-10(23)21-17-19(31-13(4)26)18(30-12(3)25)16(9-29-11(2)24)33-20(17)32-15-7-5-14(6-8-15)22(27)28/h5-8,16-20H,9H2,1-4H3,(H,21,23)/t16?,17-,18+,19?,20+/m0/s1
Synonyms:- 2-Nitrophenyl-N-Tetra-O-Acetyl-Beta-D-Glukopyranoside
- P-Nitrophenyl 2,3,4,6-Tetraacetyl-B-D-*G Lucosaminid
- 4-Nitrophenyl2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside
- (4'-Nitro)Phenyl-2-Acetamido-3,4,6-Tri-O-Acetyl-2-Deoxy-Ss-D-Glucopyranoside
- p-Nitrophenyl 2-acetamido-2-deoxy--D-glucopyranoside triacetate
- p-Nitrophenyl 2-acetamido-2-deoxy--D-glucopyranoside, 3,4,6-triacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2R,3S,4R,5R,6S)-5-Acetamido-2-(acetoxymethyl)-6-(4-nitrophenoxy)tetrahydro-2H-pyran-3,4-diyl diacetate
CAS:Formula:C20H24N2O11Color and Shape:SolidMolecular weight:468.41144-Nitrophenyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside
CAS:4-Nitrophenyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside is an extracellular nucleic acid molecule that is produced by the bacterium Corynebacterium glutamicum. This compound has been shown to inhibit cancer cells by blocking the transport of glucose through the cell membrane and may be a potential drug target for cancer treatment. 4NPTAPG has also been shown to have diagnostic properties and can identify corynebacterium glutamicum strains. It is a fluorescent molecule that can be used to detect the presence of this bacterium in culture media.Purity:Min. 95%Molecular weight:468.41 g/mol


