CymitQuimica logo

CAS 13090-17-0

:

2H-Imidazo[4,5-b]quinoxaline

Description:
2H-Imidazo[4,5-b]quinoxaline is a heterocyclic compound characterized by its fused imidazole and quinoxaline rings. This compound typically exhibits a planar structure, which contributes to its potential for π-π stacking interactions, making it interesting for applications in organic electronics and materials science. It is known for its fluorescence properties, which can be influenced by the substitution patterns on the rings. The presence of nitrogen atoms in the ring structure can also impart basicity and influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, 2H-Imidazo[4,5-b]quinoxaline has been studied for its biological activities, including potential antimicrobial and anticancer properties, due to its ability to interact with biological targets. Its solubility and stability in different solvents can vary, which is important for its application in research and development. Overall, this compound represents a versatile scaffold in medicinal chemistry and materials science.
Formula:C9H6N4
InChI:InChI=1S/C9H6N4/c1-2-4-7-6(3-1)12-8-9(13-7)11-5-10-8/h1-4H,5H2
InChI key:InChIKey=FWVZZNKHZOVUIO-UHFFFAOYSA-N
SMILES:C1=2C(N=C3C(=N1)C=CC=C3)=NCN2
Synonyms:
  • 2H-Imidazo[4,5-b]quinoxaline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.