CAS 13091-80-0
:5-Chloro-7-nitro-1H-benzotriazole
Description:
5-Chloro-7-nitro-1H-benzotriazole (CAS 13091-80-0) is an organic compound characterized by its heterocyclic structure, which includes a benzene ring fused to a triazole ring. This compound typically appears as a yellow to orange solid and is known for its stability under normal conditions. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocyclic compounds. The presence of chlorine and nitro functional groups contributes to its reactivity and potential applications in various fields, including as a corrosion inhibitor, in dye manufacturing, and as a UV absorber in plastics. Additionally, 5-Chloro-7-nitro-1H-benzotriazole may exhibit biological activity, making it of interest in pharmaceutical research. Safety data indicates that it should be handled with care, as it may pose environmental and health risks if not managed properly. Overall, this compound is significant in both industrial and research contexts due to its unique chemical properties and functional versatility.
Formula:C6H3ClN4O2
InChI:InChI=1S/C6H3ClN4O2/c7-3-1-4-6(9-10-8-4)5(2-3)11(12)13/h1-2H,(H,8,9,10)
InChI key:InChIKey=HRBBUEDJKCLTQE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=CC(Cl)=C1)N=NN2
Synonyms:- 1H-Benzotriazole, 5-chloro-7-nitro-
- 4-Nitro-6-chlorobenzotriazole
- Benzotriazole, 6-chloro-4-nitro-
- 1H-Benzotriazole, 6-chloro-4-nitro-
- 5-Chloro-7-nitro-1H-benzotriazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
