CymitQuimica logo

CAS 13092-49-4

:

4,4'-oxydibenzohydrazide

Description:
4,4'-Oxydibenzohydrazide, with the CAS number 13092-49-4, is an organic compound characterized by its hydrazide functional groups and a biphenyl structure linked by an ether oxygen atom. This compound typically appears as a white to off-white crystalline solid. It is known for its applications in various fields, including as a chemical intermediate in the synthesis of polymers and as a potential antioxidant in plastics. The presence of hydrazide groups contributes to its reactivity, allowing it to participate in condensation reactions and form derivatives. Additionally, 4,4'-oxydibenzohydrazide exhibits thermal stability, making it suitable for high-temperature applications. Its solubility varies depending on the solvent, often being more soluble in polar organic solvents. Safety data indicates that, like many hydrazine derivatives, it should be handled with care due to potential health hazards, including skin and respiratory irritation. Overall, 4,4'-oxydibenzohydrazide is a versatile compound with significant industrial relevance.
Formula:C14H14N4O3
InChI:InChI=1/C14H14N4O3/c15-17-13(19)9-1-5-11(6-2-9)21-12-7-3-10(4-8-12)14(20)18-16/h1-8H,15-16H2,(H,17,19)(H,18,20)
SMILES:c1cc(ccc1C(=O)NN)Oc1ccc(cc1)C(=O)NN
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.