CAS 130927-84-3
:2-(1-benzylpyrrolidin-3-yl)ethanamine
Description:
2-(1-benzylpyrrolidin-3-yl)ethanamine, also known by its CAS number 130927-84-3, is a chemical compound that belongs to the class of amines. It features a pyrrolidine ring substituted with a benzyl group and an ethanamine moiety, which contributes to its structural complexity. This compound is characterized by its potential psychoactive properties, as it may interact with neurotransmitter systems in the brain. The presence of the benzyl group enhances its lipophilicity, potentially affecting its pharmacokinetics and bioavailability. Additionally, the amine functional group can participate in hydrogen bonding, influencing its solubility in various solvents. The compound's molecular structure suggests it may exhibit chiral properties, leading to different biological activities depending on its stereochemistry. As with many amines, it may also be sensitive to oxidation and can form salts with acids, which can be relevant for its handling and storage. Overall, 2-(1-benzylpyrrolidin-3-yl)ethanamine is of interest in medicinal chemistry and pharmacology, warranting further investigation into its therapeutic potential and safety profile.
Formula:C13H20N2
InChI:InChI=1/C13H20N2/c14-8-6-13-7-9-15(11-13)10-12-4-2-1-3-5-12/h1-5,13H,6-11,14H2
SMILES:c1ccc(cc1)CN1CCC(CCN)C1
Synonyms:- 2-(1-Benzyl-pyrrolidin-3-yl)-ethylamine
- 3-Pyrrolidineethanamine, 1-(Phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
