CAS 13093-11-3

1-Silaacenaphthylene, 1,1-dichloro-1,2-dihydro-

Description:

1-Silaacenaphthylene, 1,1-dichloro-1,2-dihydro- is a chemical compound characterized by its unique structure, which incorporates both silicon and chlorine atoms. This compound features a silaacenaphthylene framework, where a silicon atom replaces a carbon atom in the acenaphthylene structure, contributing to its distinct chemical properties. The presence of dichloro groups indicates that two chlorine atoms are attached to the molecule, which can influence its reactivity and solubility. Typically, compounds of this nature may exhibit interesting electronic properties due to the silicon atom's ability to participate in π-bonding, potentially making it useful in materials science and organic electronics. Additionally, the chlorinated nature of the compound may enhance its reactivity, making it suitable for various synthetic applications. Overall, 1-Silaacenaphthylene, 1,1-dichloro-1,2-dihydro- represents a fascinating intersection of silicon chemistry and organic synthesis, with potential implications in advanced material development.

Formula: C₁₁H₈Cl₂Si

InChI: InChI=1S/C11H8Cl2Si/c12-14(13)7-9-5-1-3-8-4-2-6-10(14)11(8)9/h1-6H,7H2

InChI key: InChIKey=CHGCQYOYXFUYFZ-UHFFFAOYSA-N

SMILES: Cl[Si]1(Cl)C=2C3=C(C1)C=CC=C3C=CC2

Synonyms:

• 1,1-Dichloro-1-silaacenaphthene
• 1-Silaacenaphthene, 1,1-dichloro-
• 1-Silaacenaphthylene, 1,1-dichloro-1,2-dihydro-

1-Silaacenaphthylene, 1,1-dichloro-1,2-dihydro- (9CI)

CAS: 13093-11-3

Formula: C₁₁H₈Cl₂Si

Molecular weight: 239.1727

Ref: IN-DA000V4I