CymitQuimica logo

CAS 130930-49-3

:

D-2-Trifluoromethylphe

Description:
D-2-Trifluoromethylphenylalanine, commonly referred to as D-2-Trifluoromethylphe, is an amino acid derivative characterized by the presence of a trifluoromethyl group attached to the phenyl ring of the phenylalanine structure. This modification can significantly influence the compound's physicochemical properties, such as solubility, lipophilicity, and reactivity. The trifluoromethyl group is known for its electron-withdrawing effects, which can alter the electronic distribution within the molecule, potentially impacting its biological activity and interactions with proteins or enzymes. D-2-Trifluoromethylphe is often utilized in medicinal chemistry and drug design due to its ability to mimic natural amino acids while providing unique properties that can enhance the pharmacological profile of peptide-based therapeutics. Additionally, the compound may exhibit interesting characteristics in terms of stability and metabolic pathways, making it a subject of interest in research focused on developing novel therapeutic agents. As with many fluorinated compounds, considerations regarding environmental impact and toxicity are also important in its application and study.
Formula:C10H10F3NO2
InChI:InChI=1S/C10H10F3NO2/c11-10(12,13)7-4-2-1-3-6(7)5-8(14)9(15)16/h1-4,8H,5,14H2,(H,15,16)/t8-/m1/s1
InChI key:IOABLDGLYOGEHY-MRVPVSSYSA-N
SMILES:C1=CC=C(C(=C1)C[C@H](C(=O)O)N)C(F)(F)F
Synonyms:
  • D-2-Trifluoromethylphenylalanine
  • 2-Trifluoromethyl-D-phenylalanine
Found 4 products.