CAS 130931-84-9
:(1S,4R)-4-aminocyclopent-2-ene-1-carboxylic acid hydrochloride
Description:
(1S,4R)-4-aminocyclopent-2-ene-1-carboxylic acid hydrochloride, with the CAS number 130931-84-9, is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopentene ring with an amino group and a carboxylic acid functional group. This compound is a hydrochloride salt, indicating that it is typically encountered in a protonated form, enhancing its solubility in water and making it suitable for various biological applications. The presence of both the amino and carboxylic acid groups suggests that it can participate in hydrogen bonding, which may influence its reactivity and interactions with other molecules. Its stereochemistry, denoted by the (1S,4R) configuration, indicates specific spatial arrangements of its substituents, which can significantly affect its biological activity and pharmacological properties. Such compounds are often studied for their potential roles in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.
Formula:C6H10ClNO2
InChI:InChI=1/C6H9NO2.ClH/c7-5-2-1-4(3-5)6(8)9;/h1-2,4-5H,3,7H2,(H,8,9);1H/t4-,5+;/m1./s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Cyclopentene-1-carboxylic acid, 4-amino-, hydrochloride (1:1), (1S,4R)-
CAS:Formula:C6H10ClNO2Purity:95%Color and Shape:SolidMolecular weight:163.6021(1S,4R)-4-Aminocyclopent-2-enecarboxylic acid hydrochloride
CAS:(1S,4R)-4-Aminocyclopent-2-enecarboxylic acid hydrochloridePurity:95%Molecular weight:163.6g/mol(1S,4R)-4-Aminocyclopent-2-enecarboxylic acid hydrochloride
CAS:Formula:C6H10ClNO2Purity:95%Molecular weight:163.6(1S,4R)-4-Amino-2-cyclopenten-1-carboxylic Acid Hydrochloride
CAS:Controlled ProductApplications (1S,4R)-4-Amino-2-cyclopenten-1-carboxylic Acid is a γ-aminobutyric acid mimetic drug that affect dopaminergic activity.
References Gerasimov, M. et al.: Eur. J. Pharmacol., 395, 129 (2000);Formula:C6H10ClNO2Color and Shape:NeatMolecular weight:163.6




