CAS 1309315-31-8

3-(3-Azetidinyl)-5-methyl-1,2,4-oxadiazole

Description:

3-(3-Azetidinyl)-5-methyl-1,2,4-oxadiazole is a chemical compound characterized by its unique structural features, which include an oxadiazole ring and an azetidine moiety. The oxadiazole ring is a five-membered heterocycle containing two nitrogen atoms and three carbon atoms, contributing to the compound's potential biological activity. The presence of the azetidine ring, a four-membered saturated heterocycle, adds to its structural complexity and may influence its pharmacological properties. This compound is typically synthesized through specific organic reactions that involve the formation of the oxadiazole and the introduction of the azetidine group. Its potential applications may lie in medicinal chemistry, particularly in the development of new pharmaceuticals, due to the presence of both nitrogen-containing heterocycles, which are often associated with bioactivity. However, detailed studies on its specific properties, such as solubility, stability, and biological activity, would be necessary to fully understand its potential uses and implications in various fields.

Formula: C₆H₉N₃O

InChI: InChI=1S/C6H9N3O/c1-4-8-6(9-10-4)5-2-7-3-5/h5,7H,2-3H2,1H3

InChI key: InChIKey=GWUSWHFKUQRWHI-UHFFFAOYSA-N

SMILES: CC1=NC(=NO1)C2CNC2

Synonyms:

• 1,2,4-Oxadiazole, 3-(3-azetidinyl)-5-methyl-
• 3-(3-Azetidinyl)-5-methyl-1,2,4-oxadiazole