CAS 1309377-77-2

2-[(6-Chloro-5-methoxy-4-pyrimidinyl)amino]ethanol

Description:

2-[(6-Chloro-5-methoxy-4-pyrimidinyl)amino]ethanol is a chemical compound characterized by its pyrimidine ring structure, which is substituted with a chlorine atom and a methoxy group. The presence of the amino group attached to an ethanol moiety indicates that this compound has both basic and alcohol functional characteristics. This dual functionality may contribute to its solubility in polar solvents and its potential reactivity in various chemical reactions. The chloro and methoxy substituents can influence the compound's biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of the pyrimidine ring is significant, as pyrimidines are often found in nucleic acids and are important in biochemistry. Overall, 2-[(6-Chloro-5-methoxy-4-pyrimidinyl)amino]ethanol exhibits unique chemical properties that may be leveraged in various scientific and industrial applications.

Formula: C₇H₁₀ClN₃O₂

InChI: InChI=1S/C7H10ClN3O2/c1-13-5-6(8)10-4-11-7(5)9-2-3-12/h4,12H,2-3H2,1H3,(H,9,10,11)

InChI key: InChIKey=RYTCQJQGQALNFZ-UHFFFAOYSA-N

SMILES: N(CCO)C=1C(OC)=C(Cl)N=CN1

Synonyms:

• Ethanol, 2-[(6-chloro-5-methoxy-4-pyrimidinyl)amino]-
• 2-[(6-Chloro-5-methoxy-4-pyrimidinyl)amino]ethanol
• 2-[(6-Chloro-5-methoxypyrimidin-4-yl)amino]ethan-1-ol