
CAS 1309435-78-6
:(βS)-4-[[5-[(2,3-Dihydrospiro[1H-indene-1,4′-piperidin]-1′-yl)methyl]-2-thienyl]methoxy]-β-1-propyn-1-ylbenzenepropanoic acid
Description:
The chemical substance known as (βS)-4-[[5-[(2,3-Dihydrospiro[1H-indene-1,4′-piperidin]-1′-yl)methyl]-2-thienyl]methoxy]-β-1-propyn-1-ylbenzenepropanoic acid, with the CAS number 1309435-78-6, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including a propanoic acid moiety, which suggests potential acidic properties. The presence of a thienyl group and a piperidine derivative indicates that the compound may exhibit interesting pharmacological activities, possibly related to interactions with biological targets. The spirocyclic structure contributes to its three-dimensional conformation, which can influence its binding affinity and selectivity in biological systems. Additionally, the compound's propynyl and methoxy substituents may affect its solubility and reactivity. Overall, this substance is likely to be of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C31H33NO3S
InChI:InChI=1S/C31H33NO3S/c1-2-5-25(20-30(33)34)23-8-10-26(11-9-23)35-22-28-13-12-27(36-28)21-32-18-16-31(17-19-32)15-14-24-6-3-4-7-29(24)31/h3-4,6-13,25H,14-22H2,1H3,(H,33,34)/t25-/m0/s1
InChI key:InChIKey=LGIUHWQDGPFXSG-VWLOTQADSA-N
SMILES:C(N1CCC2(C=3C(CC2)=CC=CC3)CC1)C=4SC(COC5=CC=C([C@H](CC(O)=O)C#CC)C=C5)=CC4
Synonyms:- LY 2922083
- (S)-3-(4-((5-((2,3-Dihydrospiro[indene-1,4′-piperidin]-1′-yl)methyl)thiophen-2-yl)methoxy)phenyl)hex-4-ynoic acid
- Benzenepropanoic acid, 4-[[5-[(2,3-dihydrospiro[1H-indene-1,4′-piperidin]-1′-yl)methyl]-2-thienyl]methoxy]-β-1-propyn-1-yl-, (βS)-
- (βS)-4-[[5-[(2,3-Dihydrospiro[1H-indene-1,4′-piperidin]-1′-yl)methyl]-2-thienyl]methoxy]-β-1-propyn-1-ylbenzenepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
LY2922083
CAS:LY2922083: Potent, selective GPR40 agonist; lowers glucose, boosts insulin and GLP-1.Formula:C31H33NO3SColor and Shape:SolidMolecular weight:499.66
