CAS 13096-98-5

6-Chloro-5-methoxy-1H-indazole

Description:

6-Chloro-5-methoxy-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 6-position and a methoxy group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its moderate polarity due to the functional groups present. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and interactions with biological targets. As with many indazole derivatives, it may also exhibit fluorescence properties, making it useful in various analytical applications. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₇ClN₂O

InChI: InChI=1S/C8H7ClN2O/c1-12-8-2-5-4-10-11-7(5)3-6(8)9/h2-4H,1H3,(H,10,11)

InChI key: InChIKey=CHLRRKUDPILWJN-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C(=CC1Cl)NN=C2

Synonyms:

• 6-Chloro-5-methoxy-1H-indazole
• 1H-Indazole, 6-chloro-5-methoxy-
• 6-Chloro-5-methoxy indazole
• 6-Chlor-5-methoxy-indazol

1H-Indazole, 6-chloro-5-methoxy-

CAS: 13096-98-5

Formula: C₈H₇ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 182.6070

Ref: IN-DA000V6A