CAS 1309602-09-2

2-(1,1,2,2,3,3,3-Heptafluoropropyl)-6-methyl-1H-benzimidazole

Description:

2-(1,1,2,2,3,3,3-Heptafluoropropyl)-6-methyl-1H-benzimidazole is a synthetic organic compound characterized by its unique structure, which includes a benzimidazole core substituted with a heptafluoropropyl group and a methyl group. The presence of the heptafluoropropyl moiety imparts significant fluorine content, enhancing the compound's hydrophobicity and potentially influencing its chemical reactivity and stability. This compound may exhibit interesting properties such as high thermal stability and resistance to oxidation, making it suitable for various applications in materials science and pharmaceuticals. The methyl group at the 6-position of the benzimidazole ring can also affect the compound's electronic properties and steric hindrance. Overall, the combination of these substituents contributes to the compound's unique physical and chemical characteristics, which may be explored in various research and industrial contexts. However, specific data regarding its solubility, melting point, and other physical properties would require empirical investigation or reference to detailed chemical databases.

Formula: C₁₁H₇F₇N₂

InChI: InChI=1S/C11H7F7N2/c1-5-2-3-6-7(4-5)20-8(19-6)9(12,13)10(14,15)11(16,17)18/h2-4H,1H3,(H,19,20)

InChI key: InChIKey=LZUGALCGTWLULT-UHFFFAOYSA-N

SMILES: C(C(C(F)(F)F)(F)F)(F)(F)C=1NC=2C(N1)=CC=C(C)C2

Synonyms:

• 1H-Benzimidazole, 2-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methyl-
• 2-(1,1,2,2,3,3,3-Heptafluoropropyl)-6-methyl-1H-benzimidazole

2-(Heptafluoropropyl)-6-methyl-1H-benzimidazole

CAS: 1309602-09-2

2-(Heptafluoropropyl)-6-methyl-1H-benzimidazole

Molecular weight: 300.1755g/mol

Ref: 54-PC106809