CymitQuimica logo

CAS 1309602-12-7

:

4-[(2,2-Difluoroethyl)amino]phenol

Description:
4-[(2,2-Difluoroethyl)amino]phenol, identified by its CAS number 1309602-12-7, is an organic compound characterized by the presence of a phenolic group and a difluoroethyl amino substituent. This compound typically exhibits properties associated with both aromatic amines and phenols, including potential solubility in polar solvents due to the hydroxyl group. The difluoroethyl moiety introduces unique electronic and steric effects, which can influence the compound's reactivity and interaction with biological systems. As a phenolic compound, it may exhibit antioxidant properties and can participate in hydrogen bonding due to the hydroxyl group. The presence of fluorine atoms can enhance lipophilicity and alter the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological activity and safety profile. Overall, 4-[(2,2-Difluoroethyl)amino]phenol represents a unique chemical entity with potential utility in various fields.
Formula:C8H9F2NO
InChI:InChI=1S/C8H9F2NO/c9-8(10)5-11-6-1-3-7(12)4-2-6/h1-4,8,11-12H,5H2
InChI key:InChIKey=NCUGJFLIVWDFSN-UHFFFAOYSA-N
SMILES:N(CC(F)F)C1=CC=C(O)C=C1
Synonyms:
  • 4-[(2,2-Difluoroethyl)amino]phenol
  • Phenol, 4-[(2,2-difluoroethyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.