CymitQuimica logo

CAS 1309602-23-0

:

(2,2-Difluoroethoxy)ethene

Description:
(2,2-Difluoroethoxy)ethene is an organic compound characterized by the presence of both ethene and a difluoroethoxy group. Its molecular structure features a vinyl group (ethene) with an ether functional group that includes two fluorine atoms attached to the ethyl portion of the molecule. This compound is likely to exhibit properties typical of both alkenes and ethers, such as reactivity in addition reactions due to the double bond and potential solubility in organic solvents. The presence of fluorine atoms can enhance the compound's stability and influence its polarity, making it useful in various applications, including as a potential intermediate in organic synthesis or in the development of fluorinated materials. Additionally, the compound's unique characteristics may contribute to its behavior in chemical reactions, including its reactivity and interaction with other substances. As with many fluorinated compounds, safety considerations regarding toxicity and environmental impact should be taken into account during handling and application.
Formula:C4H6F2O
InChI:InChI=1S/C4H6F2O/c1-2-7-3-4(5)6/h2,4H,1,3H2
InChI key:InChIKey=DFPJZKCPOFREPN-UHFFFAOYSA-N
SMILES:C(C(F)F)OC=C
Synonyms:
  • (2,2-Difluoroethoxy)ethene
  • Ethene, (2,2-difluoroethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.