CAS 1309602-52-5

6-Nitro-2-(1,1,2,2-tetrafluoroethyl)-1H-benzimidazole

Description:

6-Nitro-2-(1,1,2,2-tetrafluoroethyl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a nitro group and a tetrafluoroethyl moiety. The presence of the nitro group typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and potential applications in various chemical reactions. The tetrafluoroethyl group contributes to the compound's hydrophobic characteristics and may enhance its stability and lipophilicity, making it of interest in pharmaceutical and agrochemical research. This compound may exhibit biological activity, potentially serving as a lead compound in drug discovery or as an intermediate in the synthesis of more complex molecules. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. As with many nitro-substituted compounds, it is essential to handle this substance with care due to potential toxicity and environmental impact.

Formula: C₉H₅F₄N₃O₂

InChI: InChI=1S/C9H5F4N3O2/c10-7(11)9(12,13)8-14-5-2-1-4(16(17)18)3-6(5)15-8/h1-3,7H,(H,14,15)

InChI key: InChIKey=WQWCQZQPBXWPSA-UHFFFAOYSA-N

SMILES: C(C(F)F)(F)(F)C=1NC=2C(N1)=CC=C(N(=O)=O)C2

Synonyms:

• 6-Nitro-2-(1,1,2,2-tetrafluoroethyl)-1H-benzimidazole
• 1H-Benzimidazole, 6-nitro-2-(1,1,2,2-tetrafluoroethyl)-

6-Nitro-2-(1,1,2,2-tetrafluoroethyl)-1H-benzimidazole

CAS: 1309602-52-5

6-Nitro-2-(1,1,2,2-tetrafluoroethyl)-1H-benzimidazole

Molecular weight: 263.14851g/mol

Ref: 54-PC107830