CymitQuimica logo

CAS 1309602-54-7

:

4-[[(3-Chlorophenyl)amino]oxy]-1,1,1,3,4,4-hexafluoro-2-butanone

Description:
4-[[(3-Chlorophenyl)amino]oxy]-1,1,1,3,4,4-hexafluoro-2-butanone is a synthetic organic compound characterized by its complex structure, which includes a hexafluoroalkyl group and an aromatic amine moiety. The presence of the hexafluoro group imparts unique properties, such as high thermal stability and low surface energy, making it useful in various applications, including pharmaceuticals and agrochemicals. The chlorophenyl group contributes to its potential biological activity, possibly influencing its interaction with biological targets. This compound is likely to exhibit moderate solubility in organic solvents, while its fluorinated nature may affect its reactivity and environmental persistence. Additionally, the presence of the amino and ether functionalities suggests potential for hydrogen bonding and reactivity in further chemical transformations. Safety and handling precautions are essential due to the presence of chlorine and fluorine, which can pose health and environmental risks. Overall, this compound exemplifies the intricate balance of functional groups that can lead to diverse applications in chemical research and industry.
Formula:C10H6ClF6NO2
InChI:InChI=1S/C10H6ClF6NO2/c11-5-2-1-3-6(4-5)18-20-10(16,17)7(12)8(19)9(13,14)15/h1-4,7,18H
InChI key:InChIKey=XSPJXIGMHDOVEW-UHFFFAOYSA-N
SMILES:N(OC(C(C(C(F)(F)F)=O)F)(F)F)C1=CC(Cl)=CC=C1
Synonyms:
  • 4-[[(3-Chlorophenyl)amino]oxy]-1,1,1,3,4,4-hexafluoro-2-butanone
  • 2-Butanone, 4-[[(3-chlorophenyl)amino]oxy]-1,1,1,3,4,4-hexafluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.