CAS 13097-08-0
:N-(4-Oxo-2-thioxo-3-thiazolidinyl)-4-pyridinecarboxamide
Description:
N-(4-Oxo-2-thioxo-3-thiazolidinyl)-4-pyridinecarboxamide, with the CAS number 13097-08-0, is a chemical compound that features a thiazolidine ring, which is characterized by a five-membered heterocyclic structure containing sulfur and nitrogen atoms. This compound exhibits a pyridine moiety, contributing to its aromatic properties and potential biological activity. The presence of the thioxo group indicates that it has a sulfur atom double-bonded to a carbon atom, which can influence its reactivity and interactions with other molecules. The oxo group suggests the presence of a carbonyl functional group, which can participate in various chemical reactions, including nucleophilic attacks. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Overall, the unique combination of functional groups and heteroatoms in this compound contributes to its chemical behavior and potential utility in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H7N3O2S2
InChI:InChI=1S/C9H7N3O2S2/c13-7-5-16-9(15)12(7)11-8(14)6-1-3-10-4-2-6/h1-4H,5H2,(H,11,14)
InChI key:InChIKey=PJRSYKJVEBWMKO-UHFFFAOYSA-N
SMILES:N(C(=O)C=1C=CN=CC1)N2C(=O)CSC2=S
Synonyms:- 3-Isonicotinamidorhodanine
- 4-Pyridinecarboxamide, N-(4-oxo-2-thioxo-3-thiazolidinyl)-
- N-(4-Oxo-2-thioxo-1,3-thiazolidin-3-yl)isonicotinamide
- N-(4-Oxo-2-thioxo-3-thiazolidinyl)-4-pyridinecarboxamide
- Isonicotinamide, N-(4-oxo-2-thioxo-3-thiazolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Pyridinecarboxamide, N-(4-oxo-2-thioxo-3-thiazolidinyl)-
CAS:Formula:C9H7N3O2S2Molecular weight:253.3008
