CAS 13097-10-4
:3-(Phenylamino)-2-thioxo-4-thiazolidinone
Description:
3-(Phenylamino)-2-thioxo-4-thiazolidinone, also known by its CAS number 13097-10-4, is a heterocyclic compound featuring a thiazolidinone core structure. This compound is characterized by the presence of a thiazolidinone ring, which includes a sulfur atom and a carbonyl group, contributing to its reactivity and potential biological activity. The phenylamino group attached to the thiazolidinone enhances its lipophilicity and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anti-inflammatory activities. Its structural features allow for various modifications, which can lead to derivatives with enhanced efficacy or selectivity. Additionally, the thiazolidinone framework is known for its ability to participate in various chemical reactions, making it a versatile building block in organic synthesis. Overall, 3-(Phenylamino)-2-thioxo-4-thiazolidinone represents a significant compound for research in drug development and synthetic chemistry.
Formula:C9H8N2OS2
InChI:InChI=1S/C9H8N2OS2/c12-8-6-14-9(13)11(8)10-7-4-2-1-3-5-7/h1-5,10H,6H2
InChI key:InChIKey=SNRGCDPTDOAQEQ-UHFFFAOYSA-N
SMILES:N(N1C(=O)CSC1=S)C2=CC=CC=C2
Synonyms:- 3-(Phenylamino)-2-thioxo-4-thiazolidinone
- 3-Anilino-2-sulfanylidene-1,3-thiazolidin-4-one
- 3-Anilino-2-thioxo-1,3-thiazolidin-4-one
- 3-Anilino-2-thioxo-thiazolidin-4-one
- 3-Anilinorhodanine
- 3-Phenylamino-2-thioxo-thiazolidin-4-one
- 4-Thiazolidinone, 3-(Phenylamino)-2-Thioxo-
- NSC 91507
- Rhodanine, 3-anilino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
