
CAS 1309783-00-3
:(6-Bromopyrazolo[1,5-a]pyrimidin-2-yl)[(1R)-3,4-dihydro-1-methyl-2(1H)-isoquinolinyl]methanone
Description:
(6-Bromopyrazolo[1,5-a]pyrimidin-2-yl)[(1R)-3,4-dihydro-1-methyl-2(1H)-isoquinolinyl]methanone is a complex organic compound characterized by its unique structural features, which include a pyrazolo-pyrimidine core and an isoquinoline moiety. The presence of a bromine atom at the 6-position of the pyrazolo ring contributes to its reactivity and potential biological activity. This compound is likely to exhibit specific pharmacological properties due to its intricate molecular structure, which may influence its interactions with biological targets. The methanone functional group suggests that it may participate in various chemical reactions, including nucleophilic attacks. Additionally, the stereochemistry indicated by the (1R) configuration suggests that the compound may exhibit chirality, potentially leading to different biological activities based on its enantiomeric forms. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and drug development, particularly in the search for novel therapeutic agents.
Formula:C17H15BrN4O
InChI:InChI=1S/C17H15BrN4O/c1-11-14-5-3-2-4-12(14)6-7-21(11)17(23)15-8-16-19-9-13(18)10-22(16)20-15/h2-5,8-11H,6-7H2,1H3/t11-/m1/s1
InChI key:InChIKey=TUYZYSNXXSTKQX-LLVKDONJSA-N
SMILES:C(=O)(C=1C=C2N(N1)C=C(Br)C=N2)N3[C@H](C)C=4C(CC3)=CC=CC4
Synonyms:- (6-Bromopyrazolo[1,5-a]pyrimidin-2-yl)[(1R)-3,4-dihydro-1-methyl-2(1H)-isoquinolinyl]methanone
- Methanone, (6-bromopyrazolo[1,5-a]pyrimidin-2-yl)[(1R)-3,4-dihydro-1-methyl-2(1H)-isoquinolinyl]-
- Remeglurant
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Remeglurant
CAS:Remeglurant is used as a selective antagonist of the mGlu5 receptor.Formula:C17H15BrN4OColor and Shape:SolidMolecular weight:371.23
